C20H26FN3O — CID 97139155
(2S)-2-(dimethylamino)-N-[2-[4-(dimethylamino)phenyl]ethyl]-2-(2-fluorophenyl)acetamide (PubChem CID 97139155) has the molecular formula C20H26FN3O and a molecular weight of 343.45 g/mol. Its IUPAC name is (2S)-2-(dimethylamino)-N-[2-[4-(dimethylamino)phenyl]ethyl]-2-(2-fluorophenyl)acetamide.
| Compound Name | (2S)-2-(dimethylamino)-N-[2-[4-(dimethylamino)phenyl]ethyl]-2-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 97139155 |
| Molecular Formula | C20H26FN3O |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | (2S)-2-(dimethylamino)-N-[2-[4-(dimethylamino)phenyl]ethyl]-2-(2-fluorophenyl)acetamide |
| SMILES | CN(C)c1ccc(CCNC(=O)[C@H](c2ccccc2F)N(C)C)cc1 |
| InChI | InChI=1S/C20H26FN3O/c1-23(2)16-11-9-15(10-12-16)13-14-22-20(25)19(24(3)4)17-7-5-6-8-18(17)21/h5-12,19H,13-14H2,1-4H3,(H,22,25)/t19-/m0/s1 |
| InChIKey | FSZJNLWZUYYKNU-IBGZPJMESA-N |
| XLogP | 2.85 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|