C17H23NO3 — CID 97139381
[(3S)-3-(cyclopropylmethyl)-3-(hydroxymethyl)piperidin-1-yl]-(4-hydroxyphenyl)methanone (PubChem CID 97139381) has the molecular formula C17H23NO3 and a molecular weight of 289.37 g/mol. Its IUPAC name is [(3S)-3-(cyclopropylmethyl)-3-(hydroxymethyl)piperidin-1-yl]-(4-hydroxyphenyl)methanone.
| Compound Name | [(3S)-3-(cyclopropylmethyl)-3-(hydroxymethyl)piperidin-1-yl]-(4-hydroxyphenyl)methanone |
|---|---|
| PubChem CID | 97139381 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | [(3S)-3-(cyclopropylmethyl)-3-(hydroxymethyl)piperidin-1-yl]-(4-hydroxyphenyl)methanone |
| SMILES | O=C(c1ccc(O)cc1)N1CCC[C@](CO)(CC2CC2)C1 |
| InChI | InChI=1S/C17H23NO3/c19-12-17(10-13-2-3-13)8-1-9-18(11-17)16(21)14-4-6-15(20)7-5-14/h4-7,13,19-20H,1-3,8-12H2/t17-/m0/s1 |
| InChIKey | UPSXVSJRIDTQPU-KRWDZBQOSA-N |
| XLogP | 2.41 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |