About 3-[(2S)-2-(3-methoxypropyl)piperidine-1-carbonyl]-1,4,6-trimethylpyridin-2-one
3-[(2S)-2-(3-methoxypropyl)piperidine-1-carbonyl]-1,4,6-trimethylpyridin-2-one (PubChem CID 97140094) has the molecular formula C18H28N2O3
and a molecular weight of 320.43 g/mol. Its IUPAC name is 3-[(2S)-2-(3-methoxypropyl)piperidine-1-carbonyl]-1,4,6-trimethylpyridin-2-one.
Molecular Properties
| Compound Name | 3-[(2S)-2-(3-methoxypropyl)piperidine-1-carbonyl]-1,4,6-trimethylpyridin-2-one |
| PubChem CID | 97140094 |
| Molecular Formula | C18H28N2O3 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | 3-[(2S)-2-(3-methoxypropyl)piperidine-1-carbonyl]-1,4,6-trimethylpyridin-2-one |
| SMILES | COCCC[C@@H]1CCCCN1C(=O)c1c(C)cc(C)n(C)c1=O |
| InChI | InChI=1S/C18H28N2O3/c1-13-12-14(2)19(3)17(21)16(13)18(22)20-10-6-5-8-15(20)9-7-11-23-4/h12,15H,5-11H2,1-4H3/t15-/m0/s1 |
| InChIKey | QGOLPHZYJFMWMU-HNNXBMFYSA-N |
| XLogP | 2.42 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2S)-2-(3-methoxypropyl)piperidine-1-carbonyl]-1,4,6-trimethylpyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2S)-2-(3-methoxypropyl)piperidine-1-carbonyl]-1,4,6-trimethylpyridin-2-one?
The IUPAC name of 3-[(2S)-2-(3-methoxypropyl)piperidine-1-carbonyl]-1,4,6-trimethylpyridin-2-one (CID 97140094) is 3-[(2S)-2-(3-methoxypropyl)piperidine-1-carbonyl]-1,4,6-trimethylpyridin-2-one.
What is the SMILES notation for 3-[(2S)-2-(3-methoxypropyl)piperidine-1-carbonyl]-1,4,6-trimethylpyridin-2-one?
The canonical SMILES for 3-[(2S)-2-(3-methoxypropyl)piperidine-1-carbonyl]-1,4,6-trimethylpyridin-2-one is COCCC[C@@H]1CCCCN1C(=O)c1c(C)cc(C)n(C)c1=O.
What is the InChIKey of 3-[(2S)-2-(3-methoxypropyl)piperidine-1-carbonyl]-1,4,6-trimethylpyridin-2-one?
The InChIKey is QGOLPHZYJFMWMU-HNNXBMFYSA-N. The full InChI is InChI=1S/C18H28N2O3/c1-13-12-14(2)19(3)17(21)16(13)18(22)20-10-6-5-8-15(20)9-7-11-23-4/h12,15H,5-11H2,1-4H3/t15-/m0/s1.
What are the key properties of 3-[(2S)-2-(3-methoxypropyl)piperidine-1-carbonyl]-1,4,6-trimethylpyridin-2-one?
3-[(2S)-2-(3-methoxypropyl)piperidine-1-carbonyl]-1,4,6-trimethylpyridin-2-one has a molecular weight of 320.43 g/mol, XLogP of 2.42, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2S)-2-(3-methoxypropyl)piperidine-1-carbonyl]-1,4,6-trimethylpyridin-2-one is sourced from PubChem (CID 97140094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).