C21H25N5O2 — CID 97140516
3-[3-oxo-3-[(2R)-2-(2-pyrazol-1-ylethyl)piperidin-1-yl]propyl]-1H-quinoxalin-2-one (PubChem CID 97140516) has the molecular formula C21H25N5O2 and a molecular weight of 379.46 g/mol. Its IUPAC name is 3-[3-oxo-3-[(2R)-2-(2-pyrazol-1-ylethyl)piperidin-1-yl]propyl]-1H-quinoxalin-2-one.
| Compound Name | 3-[3-oxo-3-[(2R)-2-(2-pyrazol-1-ylethyl)piperidin-1-yl]propyl]-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 97140516 |
| Molecular Formula | C21H25N5O2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | 3-[3-oxo-3-[(2R)-2-(2-pyrazol-1-ylethyl)piperidin-1-yl]propyl]-1H-quinoxalin-2-one |
| SMILES | O=C(CCc1nc2ccccc2[nH]c1=O)N1CCCC[C@@H]1CCn1cccn1 |
| InChI | InChI=1S/C21H25N5O2/c27-20(10-9-19-21(28)24-18-8-2-1-7-17(18)23-19)26-14-4-3-6-16(26)11-15-25-13-5-12-22-25/h1-2,5,7-8,12-13,16H,3-4,6,9-11,14-15H2,(H,24,28)/t16-/m1/s1 |
| InChIKey | GPZPDJYOBXSWHK-MRXNPFEDSA-N |
| XLogP | 2.52 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |