About [(3S)-1-[(3,4-dimethoxy-2-pyridinyl)methyl]-3-propylpiperidin-3-yl]methanol
[(3S)-1-[(3,4-dimethoxy-2-pyridinyl)methyl]-3-propylpiperidin-3-yl]methanol (PubChem CID 97141120) has the molecular formula C17H28N2O3
and a molecular weight of 308.42 g/mol. Its IUPAC name is [(3S)-1-[(3,4-dimethoxy-2-pyridinyl)methyl]-3-propylpiperidin-3-yl]methanol.
Molecular Properties
| Compound Name | [(3S)-1-[(3,4-dimethoxy-2-pyridinyl)methyl]-3-propylpiperidin-3-yl]methanol |
| PubChem CID | 97141120 |
| Molecular Formula | C17H28N2O3 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | [(3S)-1-[(3,4-dimethoxy-2-pyridinyl)methyl]-3-propylpiperidin-3-yl]methanol |
| SMILES | CCC[C@]1(CO)CCCN(Cc2nccc(OC)c2OC)C1 |
| InChI | InChI=1S/C17H28N2O3/c1-4-7-17(13-20)8-5-10-19(12-17)11-14-16(22-3)15(21-2)6-9-18-14/h6,9,20H,4-5,7-8,10-13H2,1-3H3/t17-/m0/s1 |
| InChIKey | SMWYFUZUURERFS-KRWDZBQOSA-N |
| XLogP | 2.47 |
| TPSA | 54.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(3S)-1-[(3,4-dimethoxy-2-pyridinyl)methyl]-3-propylpiperidin-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S)-1-[(3,4-dimethoxy-2-pyridinyl)methyl]-3-propylpiperidin-3-yl]methanol?
The IUPAC name of [(3S)-1-[(3,4-dimethoxy-2-pyridinyl)methyl]-3-propylpiperidin-3-yl]methanol (CID 97141120) is [(3S)-1-[(3,4-dimethoxy-2-pyridinyl)methyl]-3-propylpiperidin-3-yl]methanol.
What is the SMILES notation for [(3S)-1-[(3,4-dimethoxy-2-pyridinyl)methyl]-3-propylpiperidin-3-yl]methanol?
The canonical SMILES for [(3S)-1-[(3,4-dimethoxy-2-pyridinyl)methyl]-3-propylpiperidin-3-yl]methanol is CCC[C@]1(CO)CCCN(Cc2nccc(OC)c2OC)C1.
What is the InChIKey of [(3S)-1-[(3,4-dimethoxy-2-pyridinyl)methyl]-3-propylpiperidin-3-yl]methanol?
The InChIKey is SMWYFUZUURERFS-KRWDZBQOSA-N. The full InChI is InChI=1S/C17H28N2O3/c1-4-7-17(13-20)8-5-10-19(12-17)11-14-16(22-3)15(21-2)6-9-18-14/h6,9,20H,4-5,7-8,10-13H2,1-3H3/t17-/m0/s1.
What are the key properties of [(3S)-1-[(3,4-dimethoxy-2-pyridinyl)methyl]-3-propylpiperidin-3-yl]methanol?
[(3S)-1-[(3,4-dimethoxy-2-pyridinyl)methyl]-3-propylpiperidin-3-yl]methanol has a molecular weight of 308.42 g/mol, XLogP of 2.47, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S)-1-[(3,4-dimethoxy-2-pyridinyl)methyl]-3-propylpiperidin-3-yl]methanol is sourced from PubChem (CID 97141120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).