C15H18Cl2N2O3 — CID 97141170
(3S)-1-[2-(2,4-dichlorophenoxy)acetyl]-N-ethylpyrrolidine-3-carboxamide (PubChem CID 97141170) has the molecular formula C15H18Cl2N2O3 and a molecular weight of 345.23 g/mol. Its IUPAC name is (3S)-1-[2-(2,4-dichlorophenoxy)acetyl]-N-ethylpyrrolidine-3-carboxamide.
| Compound Name | (3S)-1-[2-(2,4-dichlorophenoxy)acetyl]-N-ethylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 97141170 |
| Molecular Formula | C15H18Cl2N2O3 |
| Molecular Weight | 345.23 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | (3S)-1-[2-(2,4-dichlorophenoxy)acetyl]-N-ethylpyrrolidine-3-carboxamide |
| SMILES | CCNC(=O)[C@H]1CCN(C(=O)COc2ccc(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C15H18Cl2N2O3/c1-2-18-15(21)10-5-6-19(8-10)14(20)9-22-13-4-3-11(16)7-12(13)17/h3-4,7,10H,2,5-6,8-9H2,1H3,(H,18,21)/t10-/m0/s1 |
| InChIKey | MVMDWSKBLCCZDO-JTQLQIEISA-N |
| XLogP | 2.36 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.23 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |