C16H32N2O4S — CID 97142125
[(3R)-1-(azepan-1-ylsulfonyl)-3-(3-methoxypropyl)piperidin-3-yl]methanol (PubChem CID 97142125) has the molecular formula C16H32N2O4S and a molecular weight of 348.51 g/mol. Its IUPAC name is [(3R)-1-(azepan-1-ylsulfonyl)-3-(3-methoxypropyl)piperidin-3-yl]methanol.
| Compound Name | [(3R)-1-(azepan-1-ylsulfonyl)-3-(3-methoxypropyl)piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 97142125 |
| Molecular Formula | C16H32N2O4S |
| Molecular Weight | 348.51 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | [(3R)-1-(azepan-1-ylsulfonyl)-3-(3-methoxypropyl)piperidin-3-yl]methanol |
| SMILES | COCCC[C@]1(CO)CCCN(S(=O)(=O)N2CCCCCC2)C1 |
| InChI | InChI=1S/C16H32N2O4S/c1-22-13-7-9-16(15-19)8-6-12-18(14-16)23(20,21)17-10-4-2-3-5-11-17/h19H,2-15H2,1H3/t16-/m1/s1 |
| InChIKey | JCGICMKULFYVJM-MRXNPFEDSA-N |
| XLogP | 1.61 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.51 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|