C21H23N3O — CID 97144056
[4-[[(3S)-1-(4-methylphthalazin-1-yl)pyrrolidin-3-yl]methyl]phenyl]methanol (PubChem CID 97144056) has the molecular formula C21H23N3O and a molecular weight of 333.44 g/mol. Its IUPAC name is [4-[[(3S)-1-(4-methylphthalazin-1-yl)pyrrolidin-3-yl]methyl]phenyl]methanol.
| Compound Name | [4-[[(3S)-1-(4-methylphthalazin-1-yl)pyrrolidin-3-yl]methyl]phenyl]methanol |
|---|---|
| PubChem CID | 97144056 |
| Molecular Formula | C21H23N3O |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | [4-[[(3S)-1-(4-methylphthalazin-1-yl)pyrrolidin-3-yl]methyl]phenyl]methanol |
| SMILES | Cc1nnc(N2CC[C@H](Cc3ccc(CO)cc3)C2)c2ccccc12 |
| InChI | InChI=1S/C21H23N3O/c1-15-19-4-2-3-5-20(19)21(23-22-15)24-11-10-18(13-24)12-16-6-8-17(14-25)9-7-16/h2-9,18,25H,10-14H2,1H3/t18-/m1/s1 |
| InChIKey | LDHSFVZLHXVLDL-GOSISDBHSA-N |
| XLogP | 3.50 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |