C16H21N3O2S — CID 97144198
(4aS,8aS)-1-[[5-(5-methylfuran-2-yl)-1H-pyrazol-4-yl]methyl]-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]thiazine (PubChem CID 97144198) has the molecular formula C16H21N3O2S and a molecular weight of 319.43 g/mol. Its IUPAC name is (4aS,8aS)-1-[[5-(5-methylfuran-2-yl)-1H-pyrazol-4-yl]methyl]-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]thiazine.
| Compound Name | (4aS,8aS)-1-[[5-(5-methylfuran-2-yl)-1H-pyrazol-4-yl]methyl]-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]thiazine |
|---|---|
| PubChem CID | 97144198 |
| Molecular Formula | C16H21N3O2S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | (4aS,8aS)-1-[[5-(5-methylfuran-2-yl)-1H-pyrazol-4-yl]methyl]-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]thiazine |
| SMILES | Cc1ccc(-c2[nH]ncc2CN2CCS[C@@H]3COCC[C@@H]32)o1 |
| InChI | InChI=1S/C16H21N3O2S/c1-11-2-3-14(21-11)16-12(8-17-18-16)9-19-5-7-22-15-10-20-6-4-13(15)19/h2-3,8,13,15H,4-7,9-10H2,1H3,(H,17,18)/t13-,15+/m0/s1 |
| InChIKey | IWHYDJZQOGBHTM-DZGCQCFKSA-N |
| XLogP | 2.68 |
| TPSA | 54.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |