C15H21N3OS2 — CID 97144222
(4aS,8aS)-1-[(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]thiazine (PubChem CID 97144222) has the molecular formula C15H21N3OS2 and a molecular weight of 323.49 g/mol. Its IUPAC name is (4aS,8aS)-1-[(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]thiazine.
| Compound Name | (4aS,8aS)-1-[(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]thiazine |
|---|---|
| PubChem CID | 97144222 |
| Molecular Formula | C15H21N3OS2 |
| Molecular Weight | 323.49 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | (4aS,8aS)-1-[(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]thiazine |
| SMILES | Cc1cn2c(CN3CCS[C@@H]4COCC[C@@H]43)c(C)nc2s1 |
| InChI | InChI=1S/C15H21N3OS2/c1-10-7-18-13(11(2)16-15(18)21-10)8-17-4-6-20-14-9-19-5-3-12(14)17/h7,12,14H,3-6,8-9H2,1-2H3/t12-,14+/m0/s1 |
| InChIKey | JQURBPDTBIRQTN-GXTWGEPZSA-N |
| XLogP | 2.72 |
| TPSA | 29.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.49 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |