C20H28N2O3 — CID 97145994
(3R)-8-(5-phenylpentanoyl)-2,8-diazaspiro[4.5]decane-3-carboxylic acid (PubChem CID 97145994) has the molecular formula C20H28N2O3 and a molecular weight of 344.45 g/mol. Its IUPAC name is (3R)-8-(5-phenylpentanoyl)-2,8-diazaspiro[4.5]decane-3-carboxylic acid.
| Compound Name | (3R)-8-(5-phenylpentanoyl)-2,8-diazaspiro[4.5]decane-3-carboxylic acid |
|---|---|
| PubChem CID | 97145994 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | (3R)-8-(5-phenylpentanoyl)-2,8-diazaspiro[4.5]decane-3-carboxylic acid |
| SMILES | O=C(O)[C@H]1CC2(CCN(C(=O)CCCCc3ccccc3)CC2)CN1 |
| InChI | InChI=1S/C20H28N2O3/c23-18(9-5-4-8-16-6-2-1-3-7-16)22-12-10-20(11-13-22)14-17(19(24)25)21-15-20/h1-3,6-7,17,21H,4-5,8-15H2,(H,24,25)/t17-/m1/s1 |
| InChIKey | RMAOOZMMXDISQR-QGZVFWFLSA-N |
| XLogP | 2.45 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|