About [(2R)-2-(4-methoxyphenyl)propyl] 5-methyl-1,3-oxazole-4-carboxylate
[(2R)-2-(4-methoxyphenyl)propyl] 5-methyl-1,3-oxazole-4-carboxylate (PubChem CID 97146324) has the molecular formula C15H17NO4
and a molecular weight of 275.30 g/mol. Its IUPAC name is [(2R)-2-(4-methoxyphenyl)propyl] 5-methyl-1,3-oxazole-4-carboxylate.
Molecular Properties
| Compound Name | [(2R)-2-(4-methoxyphenyl)propyl] 5-methyl-1,3-oxazole-4-carboxylate |
| PubChem CID | 97146324 |
| Molecular Formula | C15H17NO4 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | [(2R)-2-(4-methoxyphenyl)propyl] 5-methyl-1,3-oxazole-4-carboxylate |
| SMILES | COc1ccc([C@@H](C)COC(=O)c2ncoc2C)cc1 |
| InChI | InChI=1S/C15H17NO4/c1-10(12-4-6-13(18-3)7-5-12)8-19-15(17)14-11(2)20-9-16-14/h4-7,9-10H,8H2,1-3H3/t10-/m0/s1 |
| InChIKey | ZWQULEJTEBGEHJ-JTQLQIEISA-N |
| XLogP | 2.95 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(2R)-2-(4-methoxyphenyl)propyl] 5-methyl-1,3-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-2-(4-methoxyphenyl)propyl] 5-methyl-1,3-oxazole-4-carboxylate?
The IUPAC name of [(2R)-2-(4-methoxyphenyl)propyl] 5-methyl-1,3-oxazole-4-carboxylate (CID 97146324) is [(2R)-2-(4-methoxyphenyl)propyl] 5-methyl-1,3-oxazole-4-carboxylate.
What is the SMILES notation for [(2R)-2-(4-methoxyphenyl)propyl] 5-methyl-1,3-oxazole-4-carboxylate?
The canonical SMILES for [(2R)-2-(4-methoxyphenyl)propyl] 5-methyl-1,3-oxazole-4-carboxylate is COc1ccc([C@@H](C)COC(=O)c2ncoc2C)cc1.
What is the InChIKey of [(2R)-2-(4-methoxyphenyl)propyl] 5-methyl-1,3-oxazole-4-carboxylate?
The InChIKey is ZWQULEJTEBGEHJ-JTQLQIEISA-N. The full InChI is InChI=1S/C15H17NO4/c1-10(12-4-6-13(18-3)7-5-12)8-19-15(17)14-11(2)20-9-16-14/h4-7,9-10H,8H2,1-3H3/t10-/m0/s1.
What are the key properties of [(2R)-2-(4-methoxyphenyl)propyl] 5-methyl-1,3-oxazole-4-carboxylate?
[(2R)-2-(4-methoxyphenyl)propyl] 5-methyl-1,3-oxazole-4-carboxylate has a molecular weight of 275.30 g/mol, XLogP of 2.95, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-2-(4-methoxyphenyl)propyl] 5-methyl-1,3-oxazole-4-carboxylate is sourced from PubChem (CID 97146324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).