About [(3R)-3-prop-2-enyl-1-(1,3-thiazol-2-ylmethyl)piperidin-3-yl]methanol
[(3R)-3-prop-2-enyl-1-(1,3-thiazol-2-ylmethyl)piperidin-3-yl]methanol (PubChem CID 97146793) has the molecular formula C13H20N2OS
and a molecular weight of 252.38 g/mol. Its IUPAC name is [(3R)-3-prop-2-enyl-1-(1,3-thiazol-2-ylmethyl)piperidin-3-yl]methanol.
Molecular Properties
| Compound Name | [(3R)-3-prop-2-enyl-1-(1,3-thiazol-2-ylmethyl)piperidin-3-yl]methanol |
| PubChem CID | 97146793 |
| Molecular Formula | C13H20N2OS |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | [(3R)-3-prop-2-enyl-1-(1,3-thiazol-2-ylmethyl)piperidin-3-yl]methanol |
| SMILES | C=CC[C@]1(CO)CCCN(Cc2nccs2)C1 |
| InChI | InChI=1S/C13H20N2OS/c1-2-4-13(11-16)5-3-7-15(10-13)9-12-14-6-8-17-12/h2,6,8,16H,1,3-5,7,9-11H2/t13-/m0/s1 |
| InChIKey | RSAPHCXBEZACBN-ZDUSSCGKSA-N |
| XLogP | 2.29 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(3R)-3-prop-2-enyl-1-(1,3-thiazol-2-ylmethyl)piperidin-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-3-prop-2-enyl-1-(1,3-thiazol-2-ylmethyl)piperidin-3-yl]methanol?
The IUPAC name of [(3R)-3-prop-2-enyl-1-(1,3-thiazol-2-ylmethyl)piperidin-3-yl]methanol (CID 97146793) is [(3R)-3-prop-2-enyl-1-(1,3-thiazol-2-ylmethyl)piperidin-3-yl]methanol.
What is the SMILES notation for [(3R)-3-prop-2-enyl-1-(1,3-thiazol-2-ylmethyl)piperidin-3-yl]methanol?
The canonical SMILES for [(3R)-3-prop-2-enyl-1-(1,3-thiazol-2-ylmethyl)piperidin-3-yl]methanol is C=CC[C@]1(CO)CCCN(Cc2nccs2)C1.
What is the InChIKey of [(3R)-3-prop-2-enyl-1-(1,3-thiazol-2-ylmethyl)piperidin-3-yl]methanol?
The InChIKey is RSAPHCXBEZACBN-ZDUSSCGKSA-N. The full InChI is InChI=1S/C13H20N2OS/c1-2-4-13(11-16)5-3-7-15(10-13)9-12-14-6-8-17-12/h2,6,8,16H,1,3-5,7,9-11H2/t13-/m0/s1.
What are the key properties of [(3R)-3-prop-2-enyl-1-(1,3-thiazol-2-ylmethyl)piperidin-3-yl]methanol?
[(3R)-3-prop-2-enyl-1-(1,3-thiazol-2-ylmethyl)piperidin-3-yl]methanol has a molecular weight of 252.38 g/mol, XLogP of 2.29, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-3-prop-2-enyl-1-(1,3-thiazol-2-ylmethyl)piperidin-3-yl]methanol is sourced from PubChem (CID 97146793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).