C20H29N3O3 — CID 97147798
(3R)-3-ethyl-1-[4-(4-methylpiperazin-1-yl)benzoyl]piperidine-3-carboxylic acid (PubChem CID 97147798) has the molecular formula C20H29N3O3 and a molecular weight of 359.47 g/mol. Its IUPAC name is (3R)-3-ethyl-1-[4-(4-methylpiperazin-1-yl)benzoyl]piperidine-3-carboxylic acid.
| Compound Name | (3R)-3-ethyl-1-[4-(4-methylpiperazin-1-yl)benzoyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 97147798 |
| Molecular Formula | C20H29N3O3 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | (3R)-3-ethyl-1-[4-(4-methylpiperazin-1-yl)benzoyl]piperidine-3-carboxylic acid |
| SMILES | CC[C@@]1(C(=O)O)CCCN(C(=O)c2ccc(N3CCN(C)CC3)cc2)C1 |
| InChI | InChI=1S/C20H29N3O3/c1-3-20(19(25)26)9-4-10-23(15-20)18(24)16-5-7-17(8-6-16)22-13-11-21(2)12-14-22/h5-8H,3-4,9-15H2,1-2H3,(H,25,26)/t20-/m1/s1 |
| InChIKey | XNMGZRAWHWEXBH-HXUWFJFHSA-N |
| XLogP | 2.16 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |