C21H26N4O — CID 97147860
(4S)-2-ethyl-4-phenyl-9-pyrazin-2-yl-2,9-diazaspiro[5.5]undecan-3-one (PubChem CID 97147860) has the molecular formula C21H26N4O and a molecular weight of 350.47 g/mol. Its IUPAC name is (4S)-2-ethyl-4-phenyl-9-pyrazin-2-yl-2,9-diazaspiro[5.5]undecan-3-one.
| Compound Name | (4S)-2-ethyl-4-phenyl-9-pyrazin-2-yl-2,9-diazaspiro[5.5]undecan-3-one |
|---|---|
| PubChem CID | 97147860 |
| Molecular Formula | C21H26N4O |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | (4S)-2-ethyl-4-phenyl-9-pyrazin-2-yl-2,9-diazaspiro[5.5]undecan-3-one |
| SMILES | CCN1CC2(CCN(c3cnccn3)CC2)C[C@@H](c2ccccc2)C1=O |
| InChI | InChI=1S/C21H26N4O/c1-2-24-16-21(14-18(20(24)26)17-6-4-3-5-7-17)8-12-25(13-9-21)19-15-22-10-11-23-19/h3-7,10-11,15,18H,2,8-9,12-14,16H2,1H3/t18-/m0/s1 |
| InChIKey | MHXZOXAFTSDCGT-SFHVURJKSA-N |
| XLogP | 3.10 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |