C19H30N4O2 — CID 97148136
(5R)-9-(6-ethyl-2-pyrrolidin-1-ylpyrimidin-4-yl)-1-oxa-9-azaspiro[5.5]undecan-5-ol (PubChem CID 97148136) has the molecular formula C19H30N4O2 and a molecular weight of 346.48 g/mol. Its IUPAC name is (5R)-9-(6-ethyl-2-pyrrolidin-1-ylpyrimidin-4-yl)-1-oxa-9-azaspiro[5.5]undecan-5-ol.
| Compound Name | (5R)-9-(6-ethyl-2-pyrrolidin-1-ylpyrimidin-4-yl)-1-oxa-9-azaspiro[5.5]undecan-5-ol |
|---|---|
| PubChem CID | 97148136 |
| Molecular Formula | C19H30N4O2 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | (5R)-9-(6-ethyl-2-pyrrolidin-1-ylpyrimidin-4-yl)-1-oxa-9-azaspiro[5.5]undecan-5-ol |
| SMILES | CCc1cc(N2CCC3(CC2)OCCC[C@H]3O)nc(N2CCCC2)n1 |
| InChI | InChI=1S/C19H30N4O2/c1-2-15-14-17(21-18(20-15)23-9-3-4-10-23)22-11-7-19(8-12-22)16(24)6-5-13-25-19/h14,16,24H,2-13H2,1H3/t16-/m1/s1 |
| InChIKey | IXOFAEJXVDXQCQ-MRXNPFEDSA-N |
| XLogP | 2.15 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |