C19H25N3O4 — CID 97148392
N-[2-[4-[(5R)-6-oxo-2,7-diazaspiro[4.5]decane-2-carbonyl]phenoxy]ethyl]acetamide (PubChem CID 97148392) has the molecular formula C19H25N3O4 and a molecular weight of 359.43 g/mol. Its IUPAC name is N-[2-[4-[(5R)-6-oxo-2,7-diazaspiro[4.5]decane-2-carbonyl]phenoxy]ethyl]acetamide.
| Compound Name | N-[2-[4-[(5R)-6-oxo-2,7-diazaspiro[4.5]decane-2-carbonyl]phenoxy]ethyl]acetamide |
|---|---|
| PubChem CID | 97148392 |
| Molecular Formula | C19H25N3O4 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | N-[2-[4-[(5R)-6-oxo-2,7-diazaspiro[4.5]decane-2-carbonyl]phenoxy]ethyl]acetamide |
| SMILES | CC(=O)NCCOc1ccc(C(=O)N2CC[C@]3(CCCNC3=O)C2)cc1 |
| InChI | InChI=1S/C19H25N3O4/c1-14(23)20-10-12-26-16-5-3-15(4-6-16)17(24)22-11-8-19(13-22)7-2-9-21-18(19)25/h3-6H,2,7-13H2,1H3,(H,20,23)(H,21,25)/t19-/m1/s1 |
| InChIKey | ZEOADNTZKFHVAL-LJQANCHMSA-N |
| XLogP | 0.94 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|