C18H27N3O4 — CID 97151288
2-cyclopropyl-5-[(3R)-3-(hydroxymethyl)-3-(3-methoxypropyl)piperidine-1-carbonyl]-1H-pyrimidin-6-one (PubChem CID 97151288) has the molecular formula C18H27N3O4 and a molecular weight of 349.43 g/mol. Its IUPAC name is 2-cyclopropyl-5-[(3R)-3-(hydroxymethyl)-3-(3-methoxypropyl)piperidine-1-carbonyl]-1H-pyrimidin-6-one.
| Compound Name | 2-cyclopropyl-5-[(3R)-3-(hydroxymethyl)-3-(3-methoxypropyl)piperidine-1-carbonyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 97151288 |
| Molecular Formula | C18H27N3O4 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | 2-cyclopropyl-5-[(3R)-3-(hydroxymethyl)-3-(3-methoxypropyl)piperidine-1-carbonyl]-1H-pyrimidin-6-one |
| SMILES | COCCC[C@]1(CO)CCCN(C(=O)c2cnc(C3CC3)[nH]c2=O)C1 |
| InChI | InChI=1S/C18H27N3O4/c1-25-9-3-7-18(12-22)6-2-8-21(11-18)17(24)14-10-19-15(13-4-5-13)20-16(14)23/h10,13,22H,2-9,11-12H2,1H3,(H,19,20,23)/t18-/m1/s1 |
| InChIKey | PJUFPCCXUCDVOM-GOSISDBHSA-N |
| XLogP | 1.29 |
| TPSA | 95.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|