C15H20N4O2 — CID 97151638
(2S)-N-[(2-ethoxy-3-pyridinyl)methyl]-2-pyrazol-1-ylbutanamide (PubChem CID 97151638) has the molecular formula C15H20N4O2 and a molecular weight of 288.35 g/mol. Its IUPAC name is (2S)-N-[(2-ethoxy-3-pyridinyl)methyl]-2-pyrazol-1-ylbutanamide.
| Compound Name | (2S)-N-[(2-ethoxy-3-pyridinyl)methyl]-2-pyrazol-1-ylbutanamide |
|---|---|
| PubChem CID | 97151638 |
| Molecular Formula | C15H20N4O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | (2S)-N-[(2-ethoxy-3-pyridinyl)methyl]-2-pyrazol-1-ylbutanamide |
| SMILES | CCOc1ncccc1CNC(=O)[C@H](CC)n1cccn1 |
| InChI | InChI=1S/C15H20N4O2/c1-3-13(19-10-6-9-18-19)14(20)17-11-12-7-5-8-16-15(12)21-4-2/h5-10,13H,3-4,11H2,1-2H3,(H,17,20)/t13-/m0/s1 |
| InChIKey | URQTURUUMGWAJQ-ZDUSSCGKSA-N |
| XLogP | 1.94 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |