About (2S)-4-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]-2-methyl-2-(1-methylpyrazol-4-yl)morpholine
(2S)-4-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]-2-methyl-2-(1-methylpyrazol-4-yl)morpholine (PubChem CID 97151843) has the molecular formula C17H26N4OS
and a molecular weight of 334.49 g/mol. Its IUPAC name is (2S)-4-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]-2-methyl-2-(1-methylpyrazol-4-yl)morpholine.
Molecular Properties
| Compound Name | (2S)-4-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]-2-methyl-2-(1-methylpyrazol-4-yl)morpholine |
| PubChem CID | 97151843 |
| Molecular Formula | C17H26N4OS |
| Molecular Weight | 334.49 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | (2S)-4-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]-2-methyl-2-(1-methylpyrazol-4-yl)morpholine |
| SMILES | Cn1cc([C@@]2(C)CN(Cc3cnc(C(C)(C)C)s3)CCO2)cn1 |
| InChI | InChI=1S/C17H26N4OS/c1-16(2,3)15-18-9-14(23-15)11-21-6-7-22-17(4,12-21)13-8-19-20(5)10-13/h8-10H,6-7,11-12H2,1-5H3/t17-/m1/s1 |
| InChIKey | PNOHURGALLSALL-QGZVFWFLSA-N |
| XLogP | 2.92 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.49 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2S)-4-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]-2-methyl-2-(1-methylpyrazol-4-yl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-4-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]-2-methyl-2-(1-methylpyrazol-4-yl)morpholine?
The IUPAC name of (2S)-4-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]-2-methyl-2-(1-methylpyrazol-4-yl)morpholine (CID 97151843) is (2S)-4-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]-2-methyl-2-(1-methylpyrazol-4-yl)morpholine.
What is the SMILES notation for (2S)-4-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]-2-methyl-2-(1-methylpyrazol-4-yl)morpholine?
The canonical SMILES for (2S)-4-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]-2-methyl-2-(1-methylpyrazol-4-yl)morpholine is Cn1cc([C@@]2(C)CN(Cc3cnc(C(C)(C)C)s3)CCO2)cn1.
What is the InChIKey of (2S)-4-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]-2-methyl-2-(1-methylpyrazol-4-yl)morpholine?
The InChIKey is PNOHURGALLSALL-QGZVFWFLSA-N. The full InChI is InChI=1S/C17H26N4OS/c1-16(2,3)15-18-9-14(23-15)11-21-6-7-22-17(4,12-21)13-8-19-20(5)10-13/h8-10H,6-7,11-12H2,1-5H3/t17-/m1/s1.
What are the key properties of (2S)-4-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]-2-methyl-2-(1-methylpyrazol-4-yl)morpholine?
(2S)-4-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]-2-methyl-2-(1-methylpyrazol-4-yl)morpholine has a molecular weight of 334.49 g/mol, XLogP of 2.92, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-4-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]-2-methyl-2-(1-methylpyrazol-4-yl)morpholine is sourced from PubChem (CID 97151843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).