C19H25N5O2 — CID 97155138
morpholin-4-yl-[(3S)-3-[1-(pyridin-2-ylmethyl)imidazol-2-yl]piperidin-1-yl]methanone (PubChem CID 97155138) has the molecular formula C19H25N5O2 and a molecular weight of 355.44 g/mol. Its IUPAC name is morpholin-4-yl-[(3S)-3-[1-(pyridin-2-ylmethyl)imidazol-2-yl]piperidin-1-yl]methanone.
| Compound Name | morpholin-4-yl-[(3S)-3-[1-(pyridin-2-ylmethyl)imidazol-2-yl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 97155138 |
| Molecular Formula | C19H25N5O2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | morpholin-4-yl-[(3S)-3-[1-(pyridin-2-ylmethyl)imidazol-2-yl]piperidin-1-yl]methanone |
| SMILES | O=C(N1CCOCC1)N1CCC[C@H](c2nccn2Cc2ccccn2)C1 |
| InChI | InChI=1S/C19H25N5O2/c25-19(22-10-12-26-13-11-22)24-8-3-4-16(14-24)18-21-7-9-23(18)15-17-5-1-2-6-20-17/h1-2,5-7,9,16H,3-4,8,10-15H2/t16-/m0/s1 |
| InChIKey | CZHSFONJYDZAFT-INIZCTEOSA-N |
| XLogP | 1.96 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |