C19H26N2O3 — CID 97155939
(3S)-1-[2-(benzylamino)-2-oxoethyl]-3-(cyclopropylmethyl)piperidine-3-carboxylic acid (PubChem CID 97155939) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is (3S)-1-[2-(benzylamino)-2-oxoethyl]-3-(cyclopropylmethyl)piperidine-3-carboxylic acid.
| Compound Name | (3S)-1-[2-(benzylamino)-2-oxoethyl]-3-(cyclopropylmethyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 97155939 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | (3S)-1-[2-(benzylamino)-2-oxoethyl]-3-(cyclopropylmethyl)piperidine-3-carboxylic acid |
| SMILES | O=C(CN1CCC[C@@](CC2CC2)(C(=O)O)C1)NCc1ccccc1 |
| InChI | InChI=1S/C19H26N2O3/c22-17(20-12-16-5-2-1-3-6-16)13-21-10-4-9-19(14-21,18(23)24)11-15-7-8-15/h1-3,5-6,15H,4,7-14H2,(H,20,22)(H,23,24)/t19-/m0/s1 |
| InChIKey | LHCXBNCAUNOFPY-IBGZPJMESA-N |
| XLogP | 2.27 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |