C18H20N2OS — CID 971568
1-cyclopentyl-3-(2-phenoxyphenyl)thiourea (PubChem CID 971568) has the molecular formula C18H20N2OS and a molecular weight of 312.44 g/mol. Its IUPAC name is 1-cyclopentyl-3-(2-phenoxyphenyl)thiourea.
| Compound Name | 1-cyclopentyl-3-(2-phenoxyphenyl)thiourea |
|---|---|
| PubChem CID | 971568 |
| Molecular Formula | C18H20N2OS |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 1-cyclopentyl-3-(2-phenoxyphenyl)thiourea |
| SMILES | S=C(Nc1ccccc1Oc1ccccc1)NC1CCCC1 |
| InChI | InChI=1S/C18H20N2OS/c22-18(19-14-8-4-5-9-14)20-16-12-6-7-13-17(16)21-15-10-2-1-3-11-15/h1-3,6-7,10-14H,4-5,8-9H2,(H2,19,20,22) |
| InChIKey | DKAXCXMOXXOTKQ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|