About (2-phenyl-1,3-thiazol-5-yl)methyl (2R,3R)-2-methyloxolane-3-carboxylate
(2-phenyl-1,3-thiazol-5-yl)methyl (2R,3R)-2-methyloxolane-3-carboxylate (PubChem CID 97157485) has the molecular formula C16H17NO3S
and a molecular weight of 303.38 g/mol. Its IUPAC name is (2-phenyl-1,3-thiazol-5-yl)methyl (2R,3R)-2-methyloxolane-3-carboxylate.
Molecular Properties
| Compound Name | (2-phenyl-1,3-thiazol-5-yl)methyl (2R,3R)-2-methyloxolane-3-carboxylate |
| PubChem CID | 97157485 |
| Molecular Formula | C16H17NO3S |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | (2-phenyl-1,3-thiazol-5-yl)methyl (2R,3R)-2-methyloxolane-3-carboxylate |
| SMILES | C[C@H]1OCC[C@H]1C(=O)OCc1cnc(-c2ccccc2)s1 |
| InChI | InChI=1S/C16H17NO3S/c1-11-14(7-8-19-11)16(18)20-10-13-9-17-15(21-13)12-5-3-2-4-6-12/h2-6,9,11,14H,7-8,10H2,1H3/t11-,14-/m1/s1 |
| InChIKey | MKBSCWRRWGLAHU-BXUZGUMPSA-N |
| XLogP | 3.28 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-phenyl-1,3-thiazol-5-yl)methyl (2R,3R)-2-methyloxolane-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-phenyl-1,3-thiazol-5-yl)methyl (2R,3R)-2-methyloxolane-3-carboxylate?
The IUPAC name of (2-phenyl-1,3-thiazol-5-yl)methyl (2R,3R)-2-methyloxolane-3-carboxylate (CID 97157485) is (2-phenyl-1,3-thiazol-5-yl)methyl (2R,3R)-2-methyloxolane-3-carboxylate.
What is the SMILES notation for (2-phenyl-1,3-thiazol-5-yl)methyl (2R,3R)-2-methyloxolane-3-carboxylate?
The canonical SMILES for (2-phenyl-1,3-thiazol-5-yl)methyl (2R,3R)-2-methyloxolane-3-carboxylate is C[C@H]1OCC[C@H]1C(=O)OCc1cnc(-c2ccccc2)s1.
What is the InChIKey of (2-phenyl-1,3-thiazol-5-yl)methyl (2R,3R)-2-methyloxolane-3-carboxylate?
The InChIKey is MKBSCWRRWGLAHU-BXUZGUMPSA-N. The full InChI is InChI=1S/C16H17NO3S/c1-11-14(7-8-19-11)16(18)20-10-13-9-17-15(21-13)12-5-3-2-4-6-12/h2-6,9,11,14H,7-8,10H2,1H3/t11-,14-/m1/s1.
What are the key properties of (2-phenyl-1,3-thiazol-5-yl)methyl (2R,3R)-2-methyloxolane-3-carboxylate?
(2-phenyl-1,3-thiazol-5-yl)methyl (2R,3R)-2-methyloxolane-3-carboxylate has a molecular weight of 303.38 g/mol, XLogP of 3.28, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-phenyl-1,3-thiazol-5-yl)methyl (2R,3R)-2-methyloxolane-3-carboxylate is sourced from PubChem (CID 97157485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).