C17H30N2O3 — CID 97157617
1-[(1R,3S,4R)-2,2-diethyl-3-methoxy-4-methylcyclobutyl]-3-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]urea (PubChem CID 97157617) has the molecular formula C17H30N2O3 and a molecular weight of 310.44 g/mol. Its IUPAC name is 1-[(1R,3S,4R)-2,2-diethyl-3-methoxy-4-methylcyclobutyl]-3-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]urea.
| Compound Name | 1-[(1R,3S,4R)-2,2-diethyl-3-methoxy-4-methylcyclobutyl]-3-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]urea |
|---|---|
| PubChem CID | 97157617 |
| Molecular Formula | C17H30N2O3 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | 1-[(1R,3S,4R)-2,2-diethyl-3-methoxy-4-methylcyclobutyl]-3-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]urea |
| SMILES | CCC1(CC)[C@H](NC(=O)N[C@@H]2C=C[C@H](CO)C2)[C@@H](C)[C@@H]1OC |
| InChI | InChI=1S/C17H30N2O3/c1-5-17(6-2)14(11(3)15(17)22-4)19-16(21)18-13-8-7-12(9-13)10-20/h7-8,11-15,20H,5-6,9-10H2,1-4H3,(H2,18,19,21)/t11-,12+,13-,14-,15+/m1/s1 |
| InChIKey | QBPBYVSWRWGYIR-KHMAMNHCSA-N |
| XLogP | 2.06 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|