About N-[(2S)-1-(4,5-dimethylimidazol-1-yl)propan-2-yl]cyclohexanamine
N-[(2S)-1-(4,5-dimethylimidazol-1-yl)propan-2-yl]cyclohexanamine (PubChem CID 97159479) has the molecular formula C14H25N3
and a molecular weight of 235.38 g/mol. Its IUPAC name is N-[(2S)-1-(4,5-dimethylimidazol-1-yl)propan-2-yl]cyclohexanamine.
Molecular Properties
| Compound Name | N-[(2S)-1-(4,5-dimethylimidazol-1-yl)propan-2-yl]cyclohexanamine |
| PubChem CID | 97159479 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.38 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | N-[(2S)-1-(4,5-dimethylimidazol-1-yl)propan-2-yl]cyclohexanamine |
| SMILES | Cc1ncn(C[C@H](C)NC2CCCCC2)c1C |
| InChI | InChI=1S/C14H25N3/c1-11(16-14-7-5-4-6-8-14)9-17-10-15-12(2)13(17)3/h10-11,14,16H,4-9H2,1-3H3/t11-/m0/s1 |
| InChIKey | UGAZQMBARHQOPY-NSHDSACASA-N |
| XLogP | 2.81 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.38 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(2S)-1-(4,5-dimethylimidazol-1-yl)propan-2-yl]cyclohexanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2S)-1-(4,5-dimethylimidazol-1-yl)propan-2-yl]cyclohexanamine?
The IUPAC name of N-[(2S)-1-(4,5-dimethylimidazol-1-yl)propan-2-yl]cyclohexanamine (CID 97159479) is N-[(2S)-1-(4,5-dimethylimidazol-1-yl)propan-2-yl]cyclohexanamine.
What is the SMILES notation for N-[(2S)-1-(4,5-dimethylimidazol-1-yl)propan-2-yl]cyclohexanamine?
The canonical SMILES for N-[(2S)-1-(4,5-dimethylimidazol-1-yl)propan-2-yl]cyclohexanamine is Cc1ncn(C[C@H](C)NC2CCCCC2)c1C.
What is the InChIKey of N-[(2S)-1-(4,5-dimethylimidazol-1-yl)propan-2-yl]cyclohexanamine?
The InChIKey is UGAZQMBARHQOPY-NSHDSACASA-N. The full InChI is InChI=1S/C14H25N3/c1-11(16-14-7-5-4-6-8-14)9-17-10-15-12(2)13(17)3/h10-11,14,16H,4-9H2,1-3H3/t11-/m0/s1.
What are the key properties of N-[(2S)-1-(4,5-dimethylimidazol-1-yl)propan-2-yl]cyclohexanamine?
N-[(2S)-1-(4,5-dimethylimidazol-1-yl)propan-2-yl]cyclohexanamine has a molecular weight of 235.38 g/mol, XLogP of 2.81, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2S)-1-(4,5-dimethylimidazol-1-yl)propan-2-yl]cyclohexanamine is sourced from PubChem (CID 97159479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).