C16H17F4N3O — CID 97160056
(2S)-4-[[2-fluoro-5-(trifluoromethyl)phenyl]methyl]-2-(1-methylpyrazol-4-yl)morpholine (PubChem CID 97160056) has the molecular formula C16H17F4N3O and a molecular weight of 343.32 g/mol. Its IUPAC name is (2S)-4-[[2-fluoro-5-(trifluoromethyl)phenyl]methyl]-2-(1-methylpyrazol-4-yl)morpholine.
| Compound Name | (2S)-4-[[2-fluoro-5-(trifluoromethyl)phenyl]methyl]-2-(1-methylpyrazol-4-yl)morpholine |
|---|---|
| PubChem CID | 97160056 |
| Molecular Formula | C16H17F4N3O |
| Molecular Weight | 343.32 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | (2S)-4-[[2-fluoro-5-(trifluoromethyl)phenyl]methyl]-2-(1-methylpyrazol-4-yl)morpholine |
| SMILES | Cn1cc([C@H]2CN(Cc3cc(C(F)(F)F)ccc3F)CCO2)cn1 |
| InChI | InChI=1S/C16H17F4N3O/c1-22-8-12(7-21-22)15-10-23(4-5-24-15)9-11-6-13(16(18,19)20)2-3-14(11)17/h2-3,6-8,15H,4-5,9-10H2,1H3/t15-/m1/s1 |
| InChIKey | YBDPQFUEOTXQIM-OAHLLOKOSA-N |
| XLogP | 3.15 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.32 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |