C14H20N4OS — CID 97160147
6-methoxy-5-[[methyl-[(2R)-1-thiophen-3-ylpropan-2-yl]amino]methyl]pyrimidin-4-amine (PubChem CID 97160147) has the molecular formula C14H20N4OS and a molecular weight of 292.41 g/mol. Its IUPAC name is 6-methoxy-5-[[methyl-[(2R)-1-thiophen-3-ylpropan-2-yl]amino]methyl]pyrimidin-4-amine.
| Compound Name | 6-methoxy-5-[[methyl-[(2R)-1-thiophen-3-ylpropan-2-yl]amino]methyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 97160147 |
| Molecular Formula | C14H20N4OS |
| Molecular Weight | 292.41 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 6-methoxy-5-[[methyl-[(2R)-1-thiophen-3-ylpropan-2-yl]amino]methyl]pyrimidin-4-amine |
| SMILES | COc1ncnc(N)c1CN(C)[C@H](C)Cc1ccsc1 |
| InChI | InChI=1S/C14H20N4OS/c1-10(6-11-4-5-20-8-11)18(2)7-12-13(15)16-9-17-14(12)19-3/h4-5,8-10H,6-7H2,1-3H3,(H2,15,16,17)/t10-/m1/s1 |
| InChIKey | FIFSREKDIYYWOI-SNVBAGLBSA-N |
| XLogP | 2.19 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.41 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |