C17H14F3N3O2 — CID 97160362
5-[[(2S)-3-oxo-2-[4-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]furan-2-carbonitrile (PubChem CID 97160362) has the molecular formula C17H14F3N3O2 and a molecular weight of 349.31 g/mol. Its IUPAC name is 5-[[(2S)-3-oxo-2-[4-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]furan-2-carbonitrile.
| Compound Name | 5-[[(2S)-3-oxo-2-[4-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]furan-2-carbonitrile |
|---|---|
| PubChem CID | 97160362 |
| Molecular Formula | C17H14F3N3O2 |
| Molecular Weight | 349.31 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | 5-[[(2S)-3-oxo-2-[4-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]furan-2-carbonitrile |
| SMILES | N#Cc1ccc(CN2CCNC(=O)[C@@H]2c2ccc(C(F)(F)F)cc2)o1 |
| InChI | InChI=1S/C17H14F3N3O2/c18-17(19,20)12-3-1-11(2-4-12)15-16(24)22-7-8-23(15)10-14-6-5-13(9-21)25-14/h1-6,15H,7-8,10H2,(H,22,24)/t15-/m0/s1 |
| InChIKey | MPKYZCKKPWZVNW-HNNXBMFYSA-N |
| XLogP | 2.84 |
| TPSA | 69.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.31 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |