About N-[(6-bromoimidazo[1,2-a]pyridin-3-yl)methyl]-N-methyl-1-[(3R)-oxolan-3-yl]methanamine
N-[(6-bromoimidazo[1,2-a]pyridin-3-yl)methyl]-N-methyl-1-[(3R)-oxolan-3-yl]methanamine (PubChem CID 97160388) has the molecular formula C14H18BrN3O
and a molecular weight of 324.22 g/mol. Its IUPAC name is N-[(6-bromoimidazo[1,2-a]pyridin-3-yl)methyl]-N-methyl-1-[(3R)-oxolan-3-yl]methanamine.
Molecular Properties
| Compound Name | N-[(6-bromoimidazo[1,2-a]pyridin-3-yl)methyl]-N-methyl-1-[(3R)-oxolan-3-yl]methanamine |
| PubChem CID | 97160388 |
| Molecular Formula | C14H18BrN3O |
| Molecular Weight | 324.22 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | N-[(6-bromoimidazo[1,2-a]pyridin-3-yl)methyl]-N-methyl-1-[(3R)-oxolan-3-yl]methanamine |
| SMILES | CN(Cc1cnc2ccc(Br)cn12)C[C@H]1CCOC1 |
| InChI | InChI=1S/C14H18BrN3O/c1-17(7-11-4-5-19-10-11)9-13-6-16-14-3-2-12(15)8-18(13)14/h2-3,6,8,11H,4-5,7,9-10H2,1H3/t11-/m1/s1 |
| InChIKey | AOARQMXWLDWAKN-LLVKDONJSA-N |
| XLogP | 2.57 |
| TPSA | 29.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.22 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(6-bromoimidazo[1,2-a]pyridin-3-yl)methyl]-N-methyl-1-[(3R)-oxolan-3-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(6-bromoimidazo[1,2-a]pyridin-3-yl)methyl]-N-methyl-1-[(3R)-oxolan-3-yl]methanamine?
The IUPAC name of N-[(6-bromoimidazo[1,2-a]pyridin-3-yl)methyl]-N-methyl-1-[(3R)-oxolan-3-yl]methanamine (CID 97160388) is N-[(6-bromoimidazo[1,2-a]pyridin-3-yl)methyl]-N-methyl-1-[(3R)-oxolan-3-yl]methanamine.
What is the SMILES notation for N-[(6-bromoimidazo[1,2-a]pyridin-3-yl)methyl]-N-methyl-1-[(3R)-oxolan-3-yl]methanamine?
The canonical SMILES for N-[(6-bromoimidazo[1,2-a]pyridin-3-yl)methyl]-N-methyl-1-[(3R)-oxolan-3-yl]methanamine is CN(Cc1cnc2ccc(Br)cn12)C[C@H]1CCOC1.
What is the InChIKey of N-[(6-bromoimidazo[1,2-a]pyridin-3-yl)methyl]-N-methyl-1-[(3R)-oxolan-3-yl]methanamine?
The InChIKey is AOARQMXWLDWAKN-LLVKDONJSA-N. The full InChI is InChI=1S/C14H18BrN3O/c1-17(7-11-4-5-19-10-11)9-13-6-16-14-3-2-12(15)8-18(13)14/h2-3,6,8,11H,4-5,7,9-10H2,1H3/t11-/m1/s1.
What are the key properties of N-[(6-bromoimidazo[1,2-a]pyridin-3-yl)methyl]-N-methyl-1-[(3R)-oxolan-3-yl]methanamine?
N-[(6-bromoimidazo[1,2-a]pyridin-3-yl)methyl]-N-methyl-1-[(3R)-oxolan-3-yl]methanamine has a molecular weight of 324.22 g/mol, XLogP of 2.57, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(6-bromoimidazo[1,2-a]pyridin-3-yl)methyl]-N-methyl-1-[(3R)-oxolan-3-yl]methanamine is sourced from PubChem (CID 97160388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).