About tert-butyl N-[[(2R)-1-(imidazo[1,2-a]pyrazin-3-ylmethyl)pyrrolidin-2-yl]methyl]-N-methylcarbamate
tert-butyl N-[[(2R)-1-(imidazo[1,2-a]pyrazin-3-ylmethyl)pyrrolidin-2-yl]methyl]-N-methylcarbamate (PubChem CID 97160520) has the molecular formula C18H27N5O2
and a molecular weight of 345.45 g/mol. Its IUPAC name is tert-butyl N-[[(2R)-1-(imidazo[1,2-a]pyrazin-3-ylmethyl)pyrrolidin-2-yl]methyl]-N-methylcarbamate.
Molecular Properties
| Compound Name | tert-butyl N-[[(2R)-1-(imidazo[1,2-a]pyrazin-3-ylmethyl)pyrrolidin-2-yl]methyl]-N-methylcarbamate |
| PubChem CID | 97160520 |
| Molecular Formula | C18H27N5O2 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | tert-butyl N-[[(2R)-1-(imidazo[1,2-a]pyrazin-3-ylmethyl)pyrrolidin-2-yl]methyl]-N-methylcarbamate |
| SMILES | CN(C[C@H]1CCCN1Cc1cnc2cnccn12)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H27N5O2/c1-18(2,3)25-17(24)21(4)12-14-6-5-8-22(14)13-15-10-20-16-11-19-7-9-23(15)16/h7,9-11,14H,5-6,8,12-13H2,1-4H3/t14-/m1/s1 |
| InChIKey | IEOUWVRIWDALKV-CQSZACIVSA-N |
| XLogP | 2.56 |
| TPSA | 62.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl N-[[(2R)-1-(imidazo[1,2-a]pyrazin-3-ylmethyl)pyrrolidin-2-yl]methyl]-N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[[(2R)-1-(imidazo[1,2-a]pyrazin-3-ylmethyl)pyrrolidin-2-yl]methyl]-N-methylcarbamate?
The IUPAC name of tert-butyl N-[[(2R)-1-(imidazo[1,2-a]pyrazin-3-ylmethyl)pyrrolidin-2-yl]methyl]-N-methylcarbamate (CID 97160520) is tert-butyl N-[[(2R)-1-(imidazo[1,2-a]pyrazin-3-ylmethyl)pyrrolidin-2-yl]methyl]-N-methylcarbamate.
What is the SMILES notation for tert-butyl N-[[(2R)-1-(imidazo[1,2-a]pyrazin-3-ylmethyl)pyrrolidin-2-yl]methyl]-N-methylcarbamate?
The canonical SMILES for tert-butyl N-[[(2R)-1-(imidazo[1,2-a]pyrazin-3-ylmethyl)pyrrolidin-2-yl]methyl]-N-methylcarbamate is CN(C[C@H]1CCCN1Cc1cnc2cnccn12)C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl N-[[(2R)-1-(imidazo[1,2-a]pyrazin-3-ylmethyl)pyrrolidin-2-yl]methyl]-N-methylcarbamate?
The InChIKey is IEOUWVRIWDALKV-CQSZACIVSA-N. The full InChI is InChI=1S/C18H27N5O2/c1-18(2,3)25-17(24)21(4)12-14-6-5-8-22(14)13-15-10-20-16-11-19-7-9-23(15)16/h7,9-11,14H,5-6,8,12-13H2,1-4H3/t14-/m1/s1.
What are the key properties of tert-butyl N-[[(2R)-1-(imidazo[1,2-a]pyrazin-3-ylmethyl)pyrrolidin-2-yl]methyl]-N-methylcarbamate?
tert-butyl N-[[(2R)-1-(imidazo[1,2-a]pyrazin-3-ylmethyl)pyrrolidin-2-yl]methyl]-N-methylcarbamate has a molecular weight of 345.45 g/mol, XLogP of 2.56, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[[(2R)-1-(imidazo[1,2-a]pyrazin-3-ylmethyl)pyrrolidin-2-yl]methyl]-N-methylcarbamate is sourced from PubChem (CID 97160520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).