C14H13BrFNO2S — CID 97161938
4-bromo-N-(3,4-dimethylphenyl)-3-fluorobenzenesulfonamide (PubChem CID 97161938) has the molecular formula C14H13BrFNO2S and a molecular weight of 358.23 g/mol. Its IUPAC name is 4-bromo-N-(3,4-dimethylphenyl)-3-fluorobenzenesulfonamide.
| Compound Name | 4-bromo-N-(3,4-dimethylphenyl)-3-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 97161938 |
| Molecular Formula | C14H13BrFNO2S |
| Molecular Weight | 358.23 g/mol |
| Exact Mass | 356.98 |
| IUPAC Name | 4-bromo-N-(3,4-dimethylphenyl)-3-fluorobenzenesulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(Br)c(F)c2)cc1C |
| InChI | InChI=1S/C14H13BrFNO2S/c1-9-3-4-11(7-10(9)2)17-20(18,19)12-5-6-13(15)14(16)8-12/h3-8,17H,1-2H3 |
| InChIKey | HDUPCEZDHQEYQM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.23 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |