C11H16N4O4S — CID 97162093
(2R)-1-[(1S)-1-pyrazin-2-ylethyl]sulfonylpiperazine-2-carboxylic acid (PubChem CID 97162093) has the molecular formula C11H16N4O4S and a molecular weight of 300.34 g/mol. Its IUPAC name is (2R)-1-[(1S)-1-pyrazin-2-ylethyl]sulfonylpiperazine-2-carboxylic acid.
| Compound Name | (2R)-1-[(1S)-1-pyrazin-2-ylethyl]sulfonylpiperazine-2-carboxylic acid |
|---|---|
| PubChem CID | 97162093 |
| Molecular Formula | C11H16N4O4S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | (2R)-1-[(1S)-1-pyrazin-2-ylethyl]sulfonylpiperazine-2-carboxylic acid |
| SMILES | C[C@@H](c1cnccn1)S(=O)(=O)N1CCNC[C@@H]1C(=O)O |
| InChI | InChI=1S/C11H16N4O4S/c1-8(9-6-12-2-3-14-9)20(18,19)15-5-4-13-7-10(15)11(16)17/h2-3,6,8,10,13H,4-5,7H2,1H3,(H,16,17)/t8-,10+/m0/s1 |
| InChIKey | ICWPKUHUTKSTQH-WCBMZHEXSA-N |
| XLogP | -0.77 |
| TPSA | 112.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |