C11H18N4 — CID 97162191
(3R)-N-[(1S)-1-pyrazin-2-ylethyl]piperidin-3-amine (PubChem CID 97162191) has the molecular formula C11H18N4 and a molecular weight of 206.29 g/mol. Its IUPAC name is (3R)-N-[(1S)-1-pyrazin-2-ylethyl]piperidin-3-amine.
| Compound Name | (3R)-N-[(1S)-1-pyrazin-2-ylethyl]piperidin-3-amine |
|---|---|
| PubChem CID | 97162191 |
| Molecular Formula | C11H18N4 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | (3R)-N-[(1S)-1-pyrazin-2-ylethyl]piperidin-3-amine |
| SMILES | C[C@H](N[C@@H]1CCCNC1)c1cnccn1 |
| InChI | InChI=1S/C11H18N4/c1-9(11-8-13-5-6-14-11)15-10-3-2-4-12-7-10/h5-6,8-10,12,15H,2-4,7H2,1H3/t9-,10+/m0/s1 |
| InChIKey | ZPHCZTCPPNNFLH-VHSXEESVSA-N |
| XLogP | 0.88 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |