C13H12F2N4O — CID 971626
1-(2,4-difluorophenyl)-3-(4,6-dimethylpyrimidin-2-yl)urea (PubChem CID 971626) has the molecular formula C13H12F2N4O and a molecular weight of 278.26 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-(4,6-dimethylpyrimidin-2-yl)urea.
| Compound Name | 1-(2,4-difluorophenyl)-3-(4,6-dimethylpyrimidin-2-yl)urea |
|---|---|
| PubChem CID | 971626 |
| Molecular Formula | C13H12F2N4O |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-(4,6-dimethylpyrimidin-2-yl)urea |
| SMILES | Cc1cc(C)nc(NC(=O)Nc2ccc(F)cc2F)n1 |
| InChI | InChI=1S/C13H12F2N4O/c1-7-5-8(2)17-12(16-7)19-13(20)18-11-4-3-9(14)6-10(11)15/h3-6H,1-2H3,(H2,16,17,18,19,20) |
| InChIKey | CNSGAFSXZSRGRQ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |