C11H13N3O2S — CID 97165864
2-[(3S)-piperidin-3-yl]sulfonylpyridine-4-carbonitrile (PubChem CID 97165864) has the molecular formula C11H13N3O2S and a molecular weight of 251.31 g/mol. Its IUPAC name is 2-[(3S)-piperidin-3-yl]sulfonylpyridine-4-carbonitrile.
| Compound Name | 2-[(3S)-piperidin-3-yl]sulfonylpyridine-4-carbonitrile |
|---|---|
| PubChem CID | 97165864 |
| Molecular Formula | C11H13N3O2S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 2-[(3S)-piperidin-3-yl]sulfonylpyridine-4-carbonitrile |
| SMILES | N#Cc1ccnc(S(=O)(=O)[C@H]2CCCNC2)c1 |
| InChI | InChI=1S/C11H13N3O2S/c12-7-9-3-5-14-11(6-9)17(15,16)10-2-1-4-13-8-10/h3,5-6,10,13H,1-2,4,8H2/t10-/m0/s1 |
| InChIKey | CPNUIALZJPDWAU-JTQLQIEISA-N |
| XLogP | 0.48 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |