C9H14N2O2S2 — CID 97165913
5-[[(3R)-piperidin-3-yl]sulfonylmethyl]-1,3-thiazole (PubChem CID 97165913) has the molecular formula C9H14N2O2S2 and a molecular weight of 246.36 g/mol. Its IUPAC name is 5-[[(3R)-piperidin-3-yl]sulfonylmethyl]-1,3-thiazole.
| Compound Name | 5-[[(3R)-piperidin-3-yl]sulfonylmethyl]-1,3-thiazole |
|---|---|
| PubChem CID | 97165913 |
| Molecular Formula | C9H14N2O2S2 |
| Molecular Weight | 246.36 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | 5-[[(3R)-piperidin-3-yl]sulfonylmethyl]-1,3-thiazole |
| SMILES | O=S(=O)(Cc1cncs1)[C@@H]1CCCNC1 |
| InChI | InChI=1S/C9H14N2O2S2/c12-15(13,6-8-4-11-7-14-8)9-2-1-3-10-5-9/h4,7,9-10H,1-3,5-6H2/t9-/m1/s1 |
| InChIKey | DARKVPVNXPOKDU-SECBINFHSA-N |
| XLogP | 0.81 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.36 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |