C7H15NO3S — CID 97167965
(3S,4R)-N,3-dimethyloxane-4-sulfonamide (PubChem CID 97167965) has the molecular formula C7H15NO3S and a molecular weight of 193.27 g/mol. Its IUPAC name is (3S,4R)-N,3-dimethyloxane-4-sulfonamide.
| Compound Name | (3S,4R)-N,3-dimethyloxane-4-sulfonamide |
|---|---|
| PubChem CID | 97167965 |
| Molecular Formula | C7H15NO3S |
| Molecular Weight | 193.27 g/mol |
| Exact Mass | 193.08 |
| IUPAC Name | (3S,4R)-N,3-dimethyloxane-4-sulfonamide |
| SMILES | CNS(=O)(=O)[C@@H]1CCOC[C@@H]1C |
| InChI | InChI=1S/C7H15NO3S/c1-6-5-11-4-3-7(6)12(9,10)8-2/h6-8H,3-5H2,1-2H3/t6-,7+/m0/s1 |
| InChIKey | MBYQSQIVRXHRBH-NKWVEPMBSA-N |
| XLogP | -0.04 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.27 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |