C21H22F3N3 — CID 97168523
1-[[(3R)-1-benzylpiperidin-3-yl]methyl]-2-(trifluoromethyl)benzimidazole (PubChem CID 97168523) has the molecular formula C21H22F3N3 and a molecular weight of 373.42 g/mol. Its IUPAC name is 1-[[(3R)-1-benzylpiperidin-3-yl]methyl]-2-(trifluoromethyl)benzimidazole.
| Compound Name | 1-[[(3R)-1-benzylpiperidin-3-yl]methyl]-2-(trifluoromethyl)benzimidazole |
|---|---|
| PubChem CID | 97168523 |
| Molecular Formula | C21H22F3N3 |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 1-[[(3R)-1-benzylpiperidin-3-yl]methyl]-2-(trifluoromethyl)benzimidazole |
| SMILES | FC(F)(F)c1nc2ccccc2n1C[C@@H]1CCCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C21H22F3N3/c22-21(23,24)20-25-18-10-4-5-11-19(18)27(20)15-17-9-6-12-26(14-17)13-16-7-2-1-3-8-16/h1-5,7-8,10-11,17H,6,9,12-15H2/t17-/m1/s1 |
| InChIKey | LLNYVNYXCAUIOA-QGZVFWFLSA-N |
| XLogP | 4.97 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |