C15H20FNO — CID 97168671
(3R,4S)-N-cyclopropyl-3-[(4-fluorophenyl)methyl]oxan-4-amine (PubChem CID 97168671) has the molecular formula C15H20FNO and a molecular weight of 249.33 g/mol. Its IUPAC name is (3R,4S)-N-cyclopropyl-3-[(4-fluorophenyl)methyl]oxan-4-amine.
| Compound Name | (3R,4S)-N-cyclopropyl-3-[(4-fluorophenyl)methyl]oxan-4-amine |
|---|---|
| PubChem CID | 97168671 |
| Molecular Formula | C15H20FNO |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | (3R,4S)-N-cyclopropyl-3-[(4-fluorophenyl)methyl]oxan-4-amine |
| SMILES | Fc1ccc(C[C@H]2COCC[C@@H]2NC2CC2)cc1 |
| InChI | InChI=1S/C15H20FNO/c16-13-3-1-11(2-4-13)9-12-10-18-8-7-15(12)17-14-5-6-14/h1-4,12,14-15,17H,5-10H2/t12-,15-/m0/s1 |
| InChIKey | XZJRAGWWPVZCMA-WFASDCNBSA-N |
| XLogP | 2.53 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |