C10H17ClN2O — CID 97168789
1-[(5S,8S)-8-amino-2-azaspiro[4.4]nonan-2-yl]-2-chloroethanone (PubChem CID 97168789) has the molecular formula C10H17ClN2O and a molecular weight of 216.71 g/mol. Its IUPAC name is 1-[(5S,8S)-8-amino-2-azaspiro[4.4]nonan-2-yl]-2-chloroethanone.
| Compound Name | 1-[(5S,8S)-8-amino-2-azaspiro[4.4]nonan-2-yl]-2-chloroethanone |
|---|---|
| PubChem CID | 97168789 |
| Molecular Formula | C10H17ClN2O |
| Molecular Weight | 216.71 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | 1-[(5S,8S)-8-amino-2-azaspiro[4.4]nonan-2-yl]-2-chloroethanone |
| SMILES | N[C@H]1CC[C@]2(CCN(C(=O)CCl)C2)C1 |
| InChI | InChI=1S/C10H17ClN2O/c11-6-9(14)13-4-3-10(7-13)2-1-8(12)5-10/h8H,1-7,12H2/t8-,10-/m0/s1 |
| InChIKey | FWNCVNBGPLQFQV-WPRPVWTQSA-N |
| XLogP | 0.96 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.71 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|