C19H28N2O2 — CID 97169068
benzyl (3S)-3-[3-(cyclopropylamino)propyl]piperidine-1-carboxylate (PubChem CID 97169068) has the molecular formula C19H28N2O2 and a molecular weight of 316.44 g/mol. Its IUPAC name is benzyl (3S)-3-[3-(cyclopropylamino)propyl]piperidine-1-carboxylate.
| Compound Name | benzyl (3S)-3-[3-(cyclopropylamino)propyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 97169068 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | benzyl (3S)-3-[3-(cyclopropylamino)propyl]piperidine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCC[C@H](CCCNC2CC2)C1 |
| InChI | InChI=1S/C19H28N2O2/c22-19(23-15-17-6-2-1-3-7-17)21-13-5-9-16(14-21)8-4-12-20-18-10-11-18/h1-3,6-7,16,18,20H,4-5,8-15H2/t16-/m0/s1 |
| InChIKey | GBPMGDJKFRNYDN-INIZCTEOSA-N |
| XLogP | 3.57 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|