C11H11ClF3N3O2 — CID 97169297
(2R)-4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazine-2-carboxylic acid (PubChem CID 97169297) has the molecular formula C11H11ClF3N3O2 and a molecular weight of 309.68 g/mol. Its IUPAC name is (2R)-4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazine-2-carboxylic acid.
| Compound Name | (2R)-4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazine-2-carboxylic acid |
|---|---|
| PubChem CID | 97169297 |
| Molecular Formula | C11H11ClF3N3O2 |
| Molecular Weight | 309.68 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | (2R)-4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazine-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1CN(c2ncc(C(F)(F)F)cc2Cl)CCN1 |
| InChI | InChI=1S/C11H11ClF3N3O2/c12-7-3-6(11(13,14)15)4-17-9(7)18-2-1-16-8(5-18)10(19)20/h3-4,8,16H,1-2,5H2,(H,19,20)/t8-/m1/s1 |
| InChIKey | FZMVNGOHHYCPHF-MRVPVSSYSA-N |
| XLogP | 1.62 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.68 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |