About (4R)-2,5-diazaspiro[3.4]octan-3-one
(4R)-2,5-diazaspiro[3.4]octan-3-one (PubChem CID 97170263) has the molecular formula C6H10N2O
and a molecular weight of 126.16 g/mol. Its IUPAC name is (4R)-2,5-diazaspiro[3.4]octan-3-one.
Molecular Properties
| Compound Name | (4R)-2,5-diazaspiro[3.4]octan-3-one |
| PubChem CID | 97170263 |
| Molecular Formula | C6H10N2O |
| Molecular Weight | 126.16 g/mol |
| Exact Mass | 126.08 |
| IUPAC Name | (4R)-2,5-diazaspiro[3.4]octan-3-one |
| SMILES | O=C1NC[C@]12CCCN2 |
| InChI | InChI=1S/C6H10N2O/c9-5-6(4-7-5)2-1-3-8-6/h8H,1-4H2,(H,7,9)/t6-/m1/s1 |
| InChIKey | PJSRRPBVTJKYEP-ZCFIWIBFSA-N |
| XLogP | -0.76 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.16 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4R)-2,5-diazaspiro[3.4]octan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-2,5-diazaspiro[3.4]octan-3-one?
The IUPAC name of (4R)-2,5-diazaspiro[3.4]octan-3-one (CID 97170263) is (4R)-2,5-diazaspiro[3.4]octan-3-one.
What is the SMILES notation for (4R)-2,5-diazaspiro[3.4]octan-3-one?
The canonical SMILES for (4R)-2,5-diazaspiro[3.4]octan-3-one is O=C1NC[C@]12CCCN2.
What is the InChIKey of (4R)-2,5-diazaspiro[3.4]octan-3-one?
The InChIKey is PJSRRPBVTJKYEP-ZCFIWIBFSA-N. The full InChI is InChI=1S/C6H10N2O/c9-5-6(4-7-5)2-1-3-8-6/h8H,1-4H2,(H,7,9)/t6-/m1/s1.
What are the key properties of (4R)-2,5-diazaspiro[3.4]octan-3-one?
(4R)-2,5-diazaspiro[3.4]octan-3-one has a molecular weight of 126.16 g/mol, XLogP of -0.76, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-2,5-diazaspiro[3.4]octan-3-one is sourced from PubChem (CID 97170263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).