About 2-[(1R,6R)-6-methoxy-6-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]acetonitrile
2-[(1R,6R)-6-methoxy-6-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]acetonitrile (PubChem CID 97170427) has the molecular formula C10H10F3NO
and a molecular weight of 217.19 g/mol. Its IUPAC name is 2-[(1R,6R)-6-methoxy-6-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]acetonitrile.
Molecular Properties
| Compound Name | 2-[(1R,6R)-6-methoxy-6-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]acetonitrile |
| PubChem CID | 97170427 |
| Molecular Formula | C10H10F3NO |
| Molecular Weight | 217.19 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 2-[(1R,6R)-6-methoxy-6-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]acetonitrile |
| SMILES | CO[C@]1(C(F)(F)F)C=CC=C[C@H]1CC#N |
| InChI | InChI=1S/C10H10F3NO/c1-15-9(10(11,12)13)6-3-2-4-8(9)5-7-14/h2-4,6,8H,5H2,1H3/t8-,9+/m0/s1 |
| InChIKey | JXQZTVJRBSOUNR-DTWKUNHWSA-N |
| XLogP | 2.59 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.19 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(1R,6R)-6-methoxy-6-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1R,6R)-6-methoxy-6-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]acetonitrile?
The IUPAC name of 2-[(1R,6R)-6-methoxy-6-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]acetonitrile (CID 97170427) is 2-[(1R,6R)-6-methoxy-6-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]acetonitrile.
What is the SMILES notation for 2-[(1R,6R)-6-methoxy-6-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]acetonitrile?
The canonical SMILES for 2-[(1R,6R)-6-methoxy-6-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]acetonitrile is CO[C@]1(C(F)(F)F)C=CC=C[C@H]1CC#N.
What is the InChIKey of 2-[(1R,6R)-6-methoxy-6-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]acetonitrile?
The InChIKey is JXQZTVJRBSOUNR-DTWKUNHWSA-N. The full InChI is InChI=1S/C10H10F3NO/c1-15-9(10(11,12)13)6-3-2-4-8(9)5-7-14/h2-4,6,8H,5H2,1H3/t8-,9+/m0/s1.
What are the key properties of 2-[(1R,6R)-6-methoxy-6-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]acetonitrile?
2-[(1R,6R)-6-methoxy-6-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]acetonitrile has a molecular weight of 217.19 g/mol, XLogP of 2.59, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1R,6R)-6-methoxy-6-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]acetonitrile is sourced from PubChem (CID 97170427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).