C14H20ClN3O3 — CID 97171281
tert-butyl (3S)-3-[(5-chloropyrimidin-2-yl)oxymethyl]pyrrolidine-1-carboxylate (PubChem CID 97171281) has the molecular formula C14H20ClN3O3 and a molecular weight of 313.79 g/mol. Its IUPAC name is tert-butyl (3S)-3-[(5-chloropyrimidin-2-yl)oxymethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[(5-chloropyrimidin-2-yl)oxymethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 97171281 |
| Molecular Formula | C14H20ClN3O3 |
| Molecular Weight | 313.79 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | tert-butyl (3S)-3-[(5-chloropyrimidin-2-yl)oxymethyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](COc2ncc(Cl)cn2)C1 |
| InChI | InChI=1S/C14H20ClN3O3/c1-14(2,3)21-13(19)18-5-4-10(8-18)9-20-12-16-6-11(15)7-17-12/h6-7,10H,4-5,8-9H2,1-3H3/t10-/m0/s1 |
| InChIKey | JMBSNLNUPXUXHK-JTQLQIEISA-N |
| XLogP | 2.77 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.79 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |