C15H21BrN2O3S — CID 97173034
tert-butyl (2S)-2-[[(R)-(6-bromo-2-pyridinyl)sulfinyl]methyl]pyrrolidine-1-carboxylate (PubChem CID 97173034) has the molecular formula C15H21BrN2O3S and a molecular weight of 389.32 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[(R)-(6-bromo-2-pyridinyl)sulfinyl]methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[[(R)-(6-bromo-2-pyridinyl)sulfinyl]methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 97173034 |
| Molecular Formula | C15H21BrN2O3S |
| Molecular Weight | 389.32 g/mol |
| Exact Mass | 388.05 |
| IUPAC Name | tert-butyl (2S)-2-[[(R)-(6-bromo-2-pyridinyl)sulfinyl]methyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1C[S@@](=O)c1cccc(Br)n1 |
| InChI | InChI=1S/C15H21BrN2O3S/c1-15(2,3)21-14(19)18-9-5-6-11(18)10-22(20)13-8-4-7-12(16)17-13/h4,7-8,11H,5-6,9-10H2,1-3H3/t11-,22+/m0/s1 |
| InChIKey | BUDONALXIBLUPW-KPWVOAKYSA-N |
| XLogP | 3.35 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.32 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|