About (1S)-N,N-dimethyl-1-pyrazin-2-ylethanesulfonamide
(1S)-N,N-dimethyl-1-pyrazin-2-ylethanesulfonamide (PubChem CID 97175214) has the molecular formula C8H13N3O2S
and a molecular weight of 215.28 g/mol. Its IUPAC name is (1S)-N,N-dimethyl-1-pyrazin-2-ylethanesulfonamide.
Molecular Properties
| Compound Name | (1S)-N,N-dimethyl-1-pyrazin-2-ylethanesulfonamide |
| PubChem CID | 97175214 |
| Molecular Formula | C8H13N3O2S |
| Molecular Weight | 215.28 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | (1S)-N,N-dimethyl-1-pyrazin-2-ylethanesulfonamide |
| SMILES | C[C@@H](c1cnccn1)S(=O)(=O)N(C)C |
| InChI | InChI=1S/C8H13N3O2S/c1-7(14(12,13)11(2)3)8-6-9-4-5-10-8/h4-7H,1-3H3/t7-/m0/s1 |
| InChIKey | QKNGZEGHMMYDCA-ZETCQYMHSA-N |
| XLogP | 0.43 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.28 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1S)-N,N-dimethyl-1-pyrazin-2-ylethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-N,N-dimethyl-1-pyrazin-2-ylethanesulfonamide?
The IUPAC name of (1S)-N,N-dimethyl-1-pyrazin-2-ylethanesulfonamide (CID 97175214) is (1S)-N,N-dimethyl-1-pyrazin-2-ylethanesulfonamide.
What is the SMILES notation for (1S)-N,N-dimethyl-1-pyrazin-2-ylethanesulfonamide?
The canonical SMILES for (1S)-N,N-dimethyl-1-pyrazin-2-ylethanesulfonamide is C[C@@H](c1cnccn1)S(=O)(=O)N(C)C.
What is the InChIKey of (1S)-N,N-dimethyl-1-pyrazin-2-ylethanesulfonamide?
The InChIKey is QKNGZEGHMMYDCA-ZETCQYMHSA-N. The full InChI is InChI=1S/C8H13N3O2S/c1-7(14(12,13)11(2)3)8-6-9-4-5-10-8/h4-7H,1-3H3/t7-/m0/s1.
What are the key properties of (1S)-N,N-dimethyl-1-pyrazin-2-ylethanesulfonamide?
(1S)-N,N-dimethyl-1-pyrazin-2-ylethanesulfonamide has a molecular weight of 215.28 g/mol, XLogP of 0.43, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-N,N-dimethyl-1-pyrazin-2-ylethanesulfonamide is sourced from PubChem (CID 97175214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).