C8H13N3O2S — CID 97175214
(1S)-N,N-dimethyl-1-pyrazin-2-ylethanesulfonamide (PubChem CID 97175214) has the molecular formula C8H13N3O2S and a molecular weight of 215.28 g/mol. Its IUPAC name is (1S)-N,N-dimethyl-1-pyrazin-2-ylethanesulfonamide.
| Compound Name | (1S)-N,N-dimethyl-1-pyrazin-2-ylethanesulfonamide |
|---|---|
| PubChem CID | 97175214 |
| Molecular Formula | C8H13N3O2S |
| Molecular Weight | 215.28 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | (1S)-N,N-dimethyl-1-pyrazin-2-ylethanesulfonamide |
| SMILES | C[C@@H](c1cnccn1)S(=O)(=O)N(C)C |
| InChI | InChI=1S/C8H13N3O2S/c1-7(14(12,13)11(2)3)8-6-9-4-5-10-8/h4-7H,1-3H3/t7-/m0/s1 |
| InChIKey | QKNGZEGHMMYDCA-ZETCQYMHSA-N |
| XLogP | 0.43 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.28 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |