C15H20N2O — CID 97177566
2-[[(3R,4S)-4-(ethylamino)oxan-3-yl]methyl]benzonitrile (PubChem CID 97177566) has the molecular formula C15H20N2O and a molecular weight of 244.34 g/mol. Its IUPAC name is 2-[[(3R,4S)-4-(ethylamino)oxan-3-yl]methyl]benzonitrile.
| Compound Name | 2-[[(3R,4S)-4-(ethylamino)oxan-3-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 97177566 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | 2-[[(3R,4S)-4-(ethylamino)oxan-3-yl]methyl]benzonitrile |
| SMILES | CCN[C@H]1CCOC[C@@H]1Cc1ccccc1C#N |
| InChI | InChI=1S/C15H20N2O/c1-2-17-15-7-8-18-11-14(15)9-12-5-3-4-6-13(12)10-16/h3-6,14-15,17H,2,7-9,11H2,1H3/t14-,15-/m0/s1 |
| InChIKey | PCLWSIIGZPVSTC-GJZGRUSLSA-N |
| XLogP | 2.12 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |