About 2-amino-1-(4-methyl-2-propan-2-yl-1,3-thiazol-5-yl)ethanone
2-amino-1-(4-methyl-2-propan-2-yl-1,3-thiazol-5-yl)ethanone (PubChem CID 97178760) has the molecular formula C9H14N2OS
and a molecular weight of 198.29 g/mol. Its IUPAC name is 2-amino-1-(4-methyl-2-propan-2-yl-1,3-thiazol-5-yl)ethanone.
Molecular Properties
| Compound Name | 2-amino-1-(4-methyl-2-propan-2-yl-1,3-thiazol-5-yl)ethanone |
| PubChem CID | 97178760 |
| Molecular Formula | C9H14N2OS |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 2-amino-1-(4-methyl-2-propan-2-yl-1,3-thiazol-5-yl)ethanone |
| SMILES | Cc1nc(C(C)C)sc1C(=O)CN |
| InChI | InChI=1S/C9H14N2OS/c1-5(2)9-11-6(3)8(13-9)7(12)4-10/h5H,4,10H2,1-3H3 |
| InChIKey | RZRHWLJCRZWAFQ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-1-(4-methyl-2-propan-2-yl-1,3-thiazol-5-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1-(4-methyl-2-propan-2-yl-1,3-thiazol-5-yl)ethanone?
The IUPAC name of 2-amino-1-(4-methyl-2-propan-2-yl-1,3-thiazol-5-yl)ethanone (CID 97178760) is 2-amino-1-(4-methyl-2-propan-2-yl-1,3-thiazol-5-yl)ethanone.
What is the SMILES notation for 2-amino-1-(4-methyl-2-propan-2-yl-1,3-thiazol-5-yl)ethanone?
The canonical SMILES for 2-amino-1-(4-methyl-2-propan-2-yl-1,3-thiazol-5-yl)ethanone is Cc1nc(C(C)C)sc1C(=O)CN.
What is the InChIKey of 2-amino-1-(4-methyl-2-propan-2-yl-1,3-thiazol-5-yl)ethanone?
The InChIKey is RZRHWLJCRZWAFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2OS/c1-5(2)9-11-6(3)8(13-9)7(12)4-10/h5H,4,10H2,1-3H3.
What are the key properties of 2-amino-1-(4-methyl-2-propan-2-yl-1,3-thiazol-5-yl)ethanone?
2-amino-1-(4-methyl-2-propan-2-yl-1,3-thiazol-5-yl)ethanone has a molecular weight of 198.29 g/mol, XLogP of 1.72, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1-(4-methyl-2-propan-2-yl-1,3-thiazol-5-yl)ethanone is sourced from PubChem (CID 97178760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).